Products 1312934-58-9
CAS 1312934-58-9 is the registry number for 2,4-Dichloro-5,6,7,8-tetrahydroquinazolin-8-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5,6,7,8-tetrahydroquinazolin-8-ol (CAS 1312934-58-9) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2,4-dichloro-5,6,7,8-tetrahydroquinazolin-8-ol. InChIKey: IKBSZUBAXPXWHA-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,4-dichloro-5,6,7,8-tetrahydroquinazolin-8-ol |
| InChIKey | IKBSZUBAXPXWHA-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=NC(=N2)Cl)Cl)O |
Computed by PubChem (NCBI)