CAS 1313705-91-7 is the registry number for (R)-3-Boc-4-benzyl-1,2,3-oxathiazolidine 2,2-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl (4R)-4-benzyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1313705-91-7) is a chemical compound with the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. IUPAC name: tert-butyl (4R)-4-benzyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: GFIYMPOLIUHNDY-GFCCVEGCSA-N.
| Molecular formula | C14H19NO5S |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | tert-butyl (4R)-4-benzyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | GFIYMPOLIUHNDY-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COS1(=O)=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)