Products 757220-86-3
CAS 757220-86-3 appears in our catalog under these names: 1-[(4-Ethoxybenzene)sulfonyl]piperidine-4-carboxylic acid, 95%, 1-(4-Ethoxybenzenesulfonyl)piperidine-4-carboxylic acid, 95%, 1-(4-Ethoxybenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.
1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 757220-86-3) is a chemical compound with the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. IUPAC name: 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: QKXIQWDSURJWRJ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5S |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | QKXIQWDSURJWRJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)