CAS 862273-27-6 appears in our catalog under these names: (1R,2S)–Methyl 1–amino–2–vinylcyclopropanecarboxylate 4–methylbenzenesulfonate, (1R,2S)-Methyl 1-amino-2-vinylcyclopropanecarboxylate 4-methylbenzenesulfonate 95% mix TBC as stabilizer, Cyclopropanecarboxylic acid, 1-amino-2-ethenyl-, methyl ester, (1R,2S)-, 4-methylbenzenesulfonate (1:1), 95% mix TBC as stabilizer, 95% mix TBC as stabilizer, (1R,2S)-Methyl 1-amino-2-vinylcyclopropanecarboxylate 4-methylbenzenesulfonate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
4-methylbenzenesulfonic acid;trans-methyl (1R,2S)-1-amino-2-ethenylcyclopropane-1-carboxylate (CAS 862273-27-6) is a chemical compound with the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;trans-methyl (1R,2S)-1-amino-2-ethenylcyclopropane-1-carboxylate. InChIKey: IUHJYIOSAPJUMG-HCSZTWNASA-N.
| Molecular formula | C14H19NO5S |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;trans-methyl (1R,2S)-1-amino-2-ethenylcyclopropane-1-carboxylate |
| InChIKey | IUHJYIOSAPJUMG-HCSZTWNASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.COC(=O)[C@]1(C[C@H]1C=C)N |
Computed by PubChem (NCBI)