CAS 1091606-65-3 is the registry number for tert-Butyl (4S,5R)-4-methyl-5-phenyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4S,5R)-4-methyl-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate (CAS 1091606-65-3) is a chemical compound with the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. IUPAC name: tert-butyl (4S,5R)-4-methyl-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate. InChIKey: OVDYFNLIXOYPKC-JQWIXIFHSA-N.
| Molecular formula | C14H19NO5S |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | tert-butyl (4S,5R)-4-methyl-2,2-dioxo-5-phenyloxathiazolidine-3-carboxylate |
| InChIKey | OVDYFNLIXOYPKC-JQWIXIFHSA-N |
| SMILES | C[C@H]1[C@H](OS(=O)(=O)N1C(=O)OC(C)(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)