Products 326907-67-9

CAS 326907-67-9 is the registry number for 5-(Azepane-1-sulfonyl)-2-methoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(azepan-1-ylsulfonyl)-2-methoxybenzoic acid (CAS 326907-67-9) is a chemical compound with the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. IUPAC name: 5-(azepan-1-ylsulfonyl)-2-methoxybenzoic acid. InChIKey: SKOOSLKSZKOIFG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO5S
Molecular weight313.37 g/mol
IUPAC name5-(azepan-1-ylsulfonyl)-2-methoxybenzoic acid
InChIKeySKOOSLKSZKOIFG-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)S(=O)(=O)N2CCCCCC2)C(=O)O

Computed by PubChem (NCBI)