Products 1313730-17-4
CAS 1313730-17-4 appears in our catalog under these names: L–Ascorbic acid–13C–2, L-Ascorbic acid-13C-2, 95.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(313C)2H-furan-5-one (CAS 1313730-17-4) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 177.12 g/mol. IUPAC name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(313C)2H-furan-5-one. InChIKey: CIWBSHSKHKDKBQ-VZMNSLOISA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(313C)2H-furan-5-one |
| InChIKey | CIWBSHSKHKDKBQ-VZMNSLOISA-N |
| SMILES | C([C@@H]([C@@H]1[13C](=C(C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)