Products 178101-89-8
CAS 178101-89-8 appears in our catalog under these names: L-Ascorbic Acid-2-13C, >95% (HPLC), L-Ascorbic acid-13C-1, 99.90%. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 1 mg, 10 mg.
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(413C)2H-furan-5-one (CAS 178101-89-8) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 177.12 g/mol. IUPAC name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(413C)2H-furan-5-one. InChIKey: CIWBSHSKHKDKBQ-DXEGWCNNSA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-(413C)2H-furan-5-one |
| InChIKey | CIWBSHSKHKDKBQ-DXEGWCNNSA-N |
| SMILES | C([C@@H]([C@@H]1C(=[13C](C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)