Products 1331939-77-5
CAS 1331939-77-5 appears in our catalog under these names: L-Ascorbic Acid-13C6, >95% (HPLC), L–Ascorbic acid–13C6–1, L-Ascorbic Acid-13C6-1, L-Ascorbic acid-13C6-1, 99.37%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, 1 mg.
(2R)-2-(1,2-dihydroxy(1,2-13C2)ethyl)-3,4-dihydroxy-(2,3,4,5-13C4)2H-furan-5-one (CAS 1331939-77-5) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 182.08 g/mol. IUPAC name: (2R)-2-(1,2-dihydroxy(1,2-13C2)ethyl)-3,4-dihydroxy-(2,3,4,5-13C4)2H-furan-5-one. InChIKey: CIWBSHSKHKDKBQ-HFEVONBRSA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 182.08 g/mol |
| IUPAC name | (2R)-2-(1,2-dihydroxy(1,2-13C2)ethyl)-3,4-dihydroxy-(2,3,4,5-13C4)2H-furan-5-one |
| InChIKey | CIWBSHSKHKDKBQ-HFEVONBRSA-N |
| SMILES | [13CH2]([13CH]([13C@@H]1[13C](=[13C]([13C](=O)O1)O)O)O)O |
Computed by PubChem (NCBI)