CAS 1313734-99-4 is the registry number for Phthalic-13C6 Acid. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylic acid (CAS 1313734-99-4) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 172.09 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylic acid. InChIKey: XNGIFLGASWRNHJ-IDEBNGHGSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 172.09 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylic acid |
| InChIKey | XNGIFLGASWRNHJ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13C](=[13CH]1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)