Products 70838-83-4
CAS 70838-83-4 appears in our catalog under these names: Phthalic-13C Acid, Phthalic acid-13C. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, Get quote.
Phthalic acid (CAS 70838-83-4) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 168.12 g/mol. IUPAC name: phthalic acid. InChIKey: XNGIFLGASWRNHJ-BFGUONQLSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | phthalic acid |
| InChIKey | XNGIFLGASWRNHJ-BFGUONQLSA-N |
| SMILES | C1=CC=C(C(=C1)[13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)