CAS 1313761-59-9 is the registry number for (4-((difluoromethyl)thio)phenyl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[4-(difluoromethylsulfanyl)phenyl]boronic acid (CAS 1313761-59-9) is a chemical compound with the molecular formula C7H7BF2O2S and a molecular weight of 204.01 g/mol. IUPAC name: [4-(difluoromethylsulfanyl)phenyl]boronic acid. InChIKey: RVGSQALTUKOJSD-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2S |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | [4-(difluoromethylsulfanyl)phenyl]boronic acid |
| InChIKey | RVGSQALTUKOJSD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(F)F)(O)O |
Computed by PubChem (NCBI)