Products 1451392-37-2

CAS 1451392-37-2 appears in our catalog under these names: 2,5-Difluoro-4-(methylsulfanyl)phenylboronic acid, 95%, (2,5-Difluoro-4-(methylthio)phenyl)boronic acid, 98%, 2,5-Difluoro-4-(methylsulfanyl)phenylboronic acid, ≥95%, ≥95%, 2,5-Difluoro-4-(methylsulfanyl)phenylboronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,5-difluoro-4-methylsulfanylphenyl)boronic acid (CAS 1451392-37-2) is a chemical compound with the molecular formula C7H7BF2O2S and a molecular weight of 204.01 g/mol. IUPAC name: (2,5-difluoro-4-methylsulfanylphenyl)boronic acid. InChIKey: NEKZJMNHOSAZPI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BF2O2S
Molecular weight204.01 g/mol
IUPAC name(2,5-difluoro-4-methylsulfanylphenyl)boronic acid
InChIKeyNEKZJMNHOSAZPI-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)SC)F)(O)O

Computed by PubChem (NCBI)