Products 1451392-38-3

CAS 1451392-38-3 appears in our catalog under these names: 3,5-Difluoro-4-(methylthio)phenylboronic acid, 95%, 3,5-Difluoro-4-(methylthio)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3,5-difluoro-4-methylsulfanylphenyl)boronic acid (CAS 1451392-38-3) is a chemical compound with the molecular formula C7H7BF2O2S and a molecular weight of 204.01 g/mol. IUPAC name: (3,5-difluoro-4-methylsulfanylphenyl)boronic acid. InChIKey: UBKQQWGTISJLIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BF2O2S
Molecular weight204.01 g/mol
IUPAC name(3,5-difluoro-4-methylsulfanylphenyl)boronic acid
InChIKeyUBKQQWGTISJLIZ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)F)SC)F)(O)O

Computed by PubChem (NCBI)