CAS 861931-32-0 appears in our catalog under these names: 3,5-Difluoro-2-methylsulfanylphenylboronic acid, 95%, 3,5-Difluoro-2-methylsulfanylphenylboronic acid, ≥95%, ≥95%, 3,5-Difluoro-2-methylsulfanylphenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
(3,5-difluoro-2-methylsulfanylphenyl)boronic acid (CAS 861931-32-0) is a chemical compound with the molecular formula C7H7BF2O2S and a molecular weight of 204.01 g/mol. IUPAC name: (3,5-difluoro-2-methylsulfanylphenyl)boronic acid. InChIKey: RTISFXJQWGBLEO-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2S |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | (3,5-difluoro-2-methylsulfanylphenyl)boronic acid |
| InChIKey | RTISFXJQWGBLEO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1SC)F)F)(O)O |
Computed by PubChem (NCBI)