CAS 1451392-53-2 appears in our catalog under these names: 2,6-Difluoro-4-(methylthio)phenylboronic acid, 95%, 2,6-Difluoro-4-(methylthio)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(2,6-difluoro-4-methylsulfanylphenyl)boronic acid (CAS 1451392-53-2) is a chemical compound with the molecular formula C7H7BF2O2S and a molecular weight of 204.01 g/mol. IUPAC name: (2,6-difluoro-4-methylsulfanylphenyl)boronic acid. InChIKey: CQDPMRRHDCYXHG-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2S |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | (2,6-difluoro-4-methylsulfanylphenyl)boronic acid |
| InChIKey | CQDPMRRHDCYXHG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)SC)F)(O)O |
Computed by PubChem (NCBI)