Products 2921902-54-5

CAS 2921902-54-5 is the registry number for 5-Acetyl-6-chloronicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-acetyl-6-chloropyridine-3-carboxylic acid (CAS 2921902-54-5) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 5-acetyl-6-chloropyridine-3-carboxylic acid. InChIKey: MLIALLIXEJSTCP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO3
Molecular weight199.59 g/mol
IUPAC name5-acetyl-6-chloropyridine-3-carboxylic acid
InChIKeyMLIALLIXEJSTCP-UHFFFAOYSA-N
SMILESCC(=O)C1=C(N=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)