CAS 13142-61-5 appears in our catalog under these names: N-(3-Nitrophenyl)urea, 95%, 1-(3-Nitrophenyl)urea 95%, N-(3-nitrophenyl)urea, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(3-nitrophenyl)urea (CAS 13142-61-5) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (3-nitrophenyl)urea. InChIKey: UUIRARUHMZIJCV-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3-nitrophenyl)urea |
| InChIKey | UUIRARUHMZIJCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=O)N |
Computed by PubChem (NCBI)