CAS 1314740-58-3 appears in our catalog under these names: 2–(4–bromo–2–chlorophenyl)propan–2–amine hydrochloride, 2-(4-Bromo-2-chlorophenyl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
2-(4-bromo-2-chlorophenyl)propan-2-amine (CAS 1314740-58-3) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)propan-2-amine. InChIKey: PRBZVYNHZKIONE-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)propan-2-amine |
| InChIKey | PRBZVYNHZKIONE-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)Br)Cl)N |
Computed by PubChem (NCBI)