Products 1314755-92-4

CAS 1314755-92-4 is the registry number for 2-(4-Amino-3-fluorophenyl)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-amino-3-fluorophenyl)-2-methylpropanoic acid (CAS 1314755-92-4) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: 2-(4-amino-3-fluorophenyl)-2-methylpropanoic acid. InChIKey: NXZAFYFNSXINHB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12FNO2
Molecular weight197.21 g/mol
IUPAC name2-(4-amino-3-fluorophenyl)-2-methylpropanoic acid
InChIKeyNXZAFYFNSXINHB-UHFFFAOYSA-N
SMILESCC(C)(C1=CC(=C(C=C1)N)F)C(=O)O

Computed by PubChem (NCBI)