Products 1314793-80-0
CAS 1314793-80-0 appears in our catalog under these names: 2–(2，6–difluorophenyl)propan–2–amine hydrochloride, 2-(2,6-Difluorophenyl)propan-2-amine hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 50mg.
2-(2,6-difluorophenyl)propan-2-amine;hydrochloride (CAS 1314793-80-0) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 2-(2,6-difluorophenyl)propan-2-amine;hydrochloride. InChIKey: CRLPYFNQPVQRBZ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | CRLPYFNQPVQRBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC=C1F)F)N.Cl |
Computed by PubChem (NCBI)