CAS 1314960-90-1 is the registry number for 3,4-Diethylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4-diethylbenzenesulfonyl chloride (CAS 1314960-90-1) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 3,4-diethylbenzenesulfonyl chloride. InChIKey: POFJTJWGZDPGGE-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 3,4-diethylbenzenesulfonyl chloride |
| InChIKey | POFJTJWGZDPGGE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)S(=O)(=O)Cl)CC |
Computed by PubChem (NCBI)