CAS 91920-30-8 appears in our catalog under these names: 2,6-Diethylbenzene-1-sulfonyl chloride, 95%, 2,6-Diethylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,6-diethylbenzenesulfonyl chloride (CAS 91920-30-8) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 2,6-diethylbenzenesulfonyl chloride. InChIKey: YQPLJLXHJANWKP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 2,6-diethylbenzenesulfonyl chloride |
| InChIKey | YQPLJLXHJANWKP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)