Products 91920-30-8

CAS 91920-30-8 appears in our catalog under these names: 2,6-Diethylbenzene-1-sulfonyl chloride, 95%, 2,6-Diethylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2,6-diethylbenzenesulfonyl chloride (CAS 91920-30-8) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 2,6-diethylbenzenesulfonyl chloride. InChIKey: YQPLJLXHJANWKP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO2S
Molecular weight232.73 g/mol
IUPAC name2,6-diethylbenzenesulfonyl chloride
InChIKeyYQPLJLXHJANWKP-UHFFFAOYSA-N
SMILESCCC1=C(C(=CC=C1)CC)S(=O)(=O)Cl

Computed by PubChem (NCBI)