Products 2905-26-2
CAS 2905-26-2 appears in our catalog under these names: 3–(tert–Butyl)benzene–1–sulfonyl chloride, 3-(tert-Butyl)benzene-1-sulfonyl chloride 97%, 3-tert-Butylbenzenesulfonyl chloride, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-tert-butylbenzenesulfonyl chloride (CAS 2905-26-2) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 3-tert-butylbenzenesulfonyl chloride. InChIKey: WZQSQOIYTVCFMP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 3-tert-butylbenzenesulfonyl chloride |
| InChIKey | WZQSQOIYTVCFMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-tert-butylbenzene-1-sulfonyl chloride, 3-(1,1-dimethylethyl)benzenesulfonyl chloride, 3-tert-butylbenzenesulfonyl Chloride, 3-tert-Butyl benzenesulfonyl chloride, 3-(tert-Butyl)benzene-1-sulfonyl chloride, Benzenesulfonyl chloride, 3-(1,1-dimethylethyl)-, 3-tert-butylphenylsulphonyl chloride, 3-(tert-Butyl)benzenesulfonyl Chloride, 3-tert-butylphenylsulfonyl chloride, 3-(Tert-butyl)pheny