CAS 88107-02-2 appears in our catalog under these names: 4-Phenylbutane-1-sulfonyl chloride, 95%, 4-Phenylbutane-1-sulfonyl Chloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
4-phenylbutane-1-sulfonyl chloride (CAS 88107-02-2) is a chemical compound with the molecular formula C10H13ClO2S and a molecular weight of 232.73 g/mol. IUPAC name: 4-phenylbutane-1-sulfonyl chloride. InChIKey: STNOVOXCNZFDME-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2S |
|---|---|
| Molecular weight | 232.73 g/mol |
| IUPAC name | 4-phenylbutane-1-sulfonyl chloride |
| InChIKey | STNOVOXCNZFDME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)