Products 1315259-16-5
CAS 1315259-16-5 is the registry number for (4'-(Hydroxymethyl)-[1,1'-biphenyl]-4-yl)boronic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-[4-(hydroxymethyl)phenyl]phenyl]boronic acid (CAS 1315259-16-5) is a chemical compound with the molecular formula C13H13BO3 and a molecular weight of 228.05 g/mol. IUPAC name: [4-[4-(hydroxymethyl)phenyl]phenyl]boronic acid. InChIKey: KQYVSZDZPJQXEL-UHFFFAOYSA-N.
| Molecular formula | C13H13BO3 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | [4-[4-(hydroxymethyl)phenyl]phenyl]boronic acid |
| InChIKey | KQYVSZDZPJQXEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)CO)(O)O |
Computed by PubChem (NCBI)