Products 1646842-34-3
CAS 1646842-34-3 appears in our catalog under these names: 4-Bromo-5-fluoro-2-methylphenylboronic acid, 98%, 4-Bromo-5-fluoro-2-methylphenylboronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 25g.
(4-bromo-5-fluoro-2-methylphenyl)boronic acid (CAS 1646842-34-3) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: (4-bromo-5-fluoro-2-methylphenyl)boronic acid. InChIKey: OZAGLHAPIPPEJJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | (4-bromo-5-fluoro-2-methylphenyl)boronic acid |
| InChIKey | OZAGLHAPIPPEJJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Br)F)(O)O |
Computed by PubChem (NCBI)