Products 1315364-11-4
CAS 1315364-11-4 is the registry number for (6-Chlorothieno[3,2-c]pyridin-2-yl)methanol, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(6-chlorothieno[3,2-c]pyridin-2-yl)methanol (CAS 1315364-11-4) is a chemical compound with the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. IUPAC name: (6-chlorothieno[3,2-c]pyridin-2-yl)methanol. InChIKey: UHMAYKNPGZBXFK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNOS |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | (6-chlorothieno[3,2-c]pyridin-2-yl)methanol |
| InChIKey | UHMAYKNPGZBXFK-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=CC(=NC=C21)Cl)CO |
Computed by PubChem (NCBI)