CAS 1315366-77-8 appears in our catalog under these names: Ethyl({1-(3-(trifluoromethyl)phenyl)ethyl})amine hydrochloride, 95%, Ethyl({1-(3-(trifluoromethyl)phenyl)ethyl})amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
N-ethyl-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 1315366-77-8) is a chemical compound with the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. IUPAC name: N-ethyl-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: PLFADWBEQUKYDW-UHFFFAOYSA-N.
| Molecular formula | C11H15ClF3N |
|---|---|
| Molecular weight | 253.69 g/mol |
| IUPAC name | N-ethyl-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | PLFADWBEQUKYDW-UHFFFAOYSA-N |
| SMILES | CCNC(C)C1=CC(=CC=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)