CAS 2060041-18-9 is the registry number for 1,1,1-Trifluoro-5-phenylpentan-3-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,1,1-trifluoro-5-phenylpentan-3-amine;hydrochloride (CAS 2060041-18-9) is a chemical compound with the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. IUPAC name: 1,1,1-trifluoro-5-phenylpentan-3-amine;hydrochloride. InChIKey: NRWKDHYQGKGRAV-UHFFFAOYSA-N.
| Molecular formula | C11H15ClF3N |
|---|---|
| Molecular weight | 253.69 g/mol |
| IUPAC name | 1,1,1-trifluoro-5-phenylpentan-3-amine;hydrochloride |
| InChIKey | NRWKDHYQGKGRAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(CC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)