CAS 2490709-13-0 is the registry number for 2-[4-(trifluoromethyl)phenyl]butan-1-amine hydrochloride (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-[4-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride (CAS 2490709-13-0) is a chemical compound with the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride. InChIKey: QROQEHJFXLKRCC-UHFFFAOYSA-N.
| Molecular formula | C11H15ClF3N |
|---|---|
| Molecular weight | 253.69 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride |
| InChIKey | QROQEHJFXLKRCC-UHFFFAOYSA-N |
| SMILES | CCC(CN)C1=CC=C(C=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)