CAS 959139-62-9 appears in our catalog under these names: 2-Methyl-2-(3-trifluoromethylphenyl)propylamine hydrochloride, 98%, 2-Methyl-2-(3-(trifluoromethyl)phenyl)propan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 959139-62-9) is a chemical compound with the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. IUPAC name: 2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: UDZJWGCDZPFEMK-UHFFFAOYSA-N.
| Molecular formula | C11H15ClF3N |
|---|---|
| Molecular weight | 253.69 g/mol |
| IUPAC name | 2-methyl-2-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | UDZJWGCDZPFEMK-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC(=CC=C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)