Products 1391423-72-5
CAS 1391423-72-5 appears in our catalog under these names: (1R)-2-Methyl-1-[4-(trifluoromethyl)phenyl]propylamine hydrochloride, 95%, (R)–2–Methyl–1–(4–(trifluoromethyl)phenyl)propan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(1R)-2-methyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 1391423-72-5) is a chemical compound with the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. IUPAC name: (1R)-2-methyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: CJNUAORXKUDOAK-HNCPQSOCSA-N.
| Molecular formula | C11H15ClF3N |
|---|---|
| Molecular weight | 253.69 g/mol |
| IUPAC name | (1R)-2-methyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | CJNUAORXKUDOAK-HNCPQSOCSA-N |
| SMILES | CC(C)[C@H](C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)