CAS 525538-99-2 is the registry number for 2-(3,4-Dichlorophenyl)-3-methylpyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)-3-methylpyrrolidine (CAS 525538-99-2) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-3-methylpyrrolidine. InChIKey: PSMCMOUKYWGZKG-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-3-methylpyrrolidine |
| InChIKey | PSMCMOUKYWGZKG-UHFFFAOYSA-N |
| SMILES | CC1CCNC1C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)