CAS 1315372-63-4 appears in our catalog under these names: 4-((7-Fluoroquinolin-4-yl)amino)benzoic acid, 97%, 4-((7-Fluoroquinolin-4-yl)amino)benzoic acid, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[(7-fluoroquinolin-4-yl)amino]benzoic acid (CAS 1315372-63-4) is a chemical compound with the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. IUPAC name: 4-[(7-fluoroquinolin-4-yl)amino]benzoic acid. InChIKey: QJIJAMGPDVSBIJ-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O2 |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | 4-[(7-fluoroquinolin-4-yl)amino]benzoic acid |
| InChIKey | QJIJAMGPDVSBIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC2=C3C=CC(=CC3=NC=C2)F |
Computed by PubChem (NCBI)