CAS 618102-72-0 is the registry number for 3-(4-Fluorophenyl)-1-phenyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxylic acid (CAS 618102-72-0) is a chemical compound with the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. IUPAC name: 3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxylic acid. InChIKey: AUGGLACBFCDDGJ-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O2 |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1-phenylpyrazole-5-carboxylic acid |
| InChIKey | AUGGLACBFCDDGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)