CAS 926237-30-1 appears in our catalog under these names: 4-(5-(4-Fluorophenyl)-1H-pyrazol-1-yl)benzoic acid, 95%, 4-(5-(4-Fluorophenyl)-1H-pyrazol-1-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-[5-(4-fluorophenyl)pyrazol-1-yl]benzoic acid (CAS 926237-30-1) is a chemical compound with the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. IUPAC name: 4-[5-(4-fluorophenyl)pyrazol-1-yl]benzoic acid. InChIKey: QSVBYSXSSQFFRN-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O2 |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | 4-[5-(4-fluorophenyl)pyrazol-1-yl]benzoic acid |
| InChIKey | QSVBYSXSSQFFRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NN2C3=CC=C(C=C3)C(=O)O)F |
Computed by PubChem (NCBI)