CAS 618101-93-2 appears in our catalog under these names: 1-(4-Fluorophenyl)-3-phenyl-1h-pyrazole-5-carboxylic acid, 95%, 1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid, 97%, 1-(4-Fluorophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid, 1-(4-Fluoro-phenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg, 1000mg, 500mg.
1-(4-fluorophenyl)-3-phenylpyrazole-5-carboxylic acid (CAS 618101-93-2) is a chemical compound with the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-phenylpyrazole-5-carboxylic acid. InChIKey: XZVHZHLRTMJELS-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O2 |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-phenylpyrazole-5-carboxylic acid |
| InChIKey | XZVHZHLRTMJELS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)