CAS 288401-60-5 is the registry number for (5-Fluoro-2-hydroxyphenyl)(1-phenyl-1H-pyrazol-4-yl)methanone, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg, 250mg, 500mg.
(5-fluoro-2-hydroxyphenyl)-(1-phenylpyrazol-4-yl)methanone (CAS 288401-60-5) is a chemical compound with the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. IUPAC name: (5-fluoro-2-hydroxyphenyl)-(1-phenylpyrazol-4-yl)methanone. InChIKey: LUIKVPFJGVQNCR-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O2 |
|---|---|
| Molecular weight | 282.27 g/mol |
| IUPAC name | (5-fluoro-2-hydroxyphenyl)-(1-phenylpyrazol-4-yl)methanone |
| InChIKey | LUIKVPFJGVQNCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=N2)C(=O)C3=C(C=CC(=C3)F)O |
Computed by PubChem (NCBI)