CAS 131550-06-6 appears in our catalog under these names: 2,4-anhydro-3,5-O-((S)-phenylmethylene)-D-Lyxonic acidmethyl ester, Methyl (1S,3S,6R,8S)–3–phenyl–2,4,7–trioxabicyclo(4·2·0)octane–8–carboxylate, 2,4-Anhydro-3,5-O-((S)-phenylmethylene)- D-lyxonic acid methyl ester. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 10mg, 25mg.
Methyl (1S,3S,6R,8S)-3-phenyl-2,4,7-trioxabicyclo[4.2.0]octane-8-carboxylate (CAS 131550-06-6) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: methyl (1S,3S,6R,8S)-3-phenyl-2,4,7-trioxabicyclo[4.2.0]octane-8-carboxylate. InChIKey: YLWSGWORUDULID-BLFANLJRSA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | methyl (1S,3S,6R,8S)-3-phenyl-2,4,7-trioxabicyclo[4.2.0]octane-8-carboxylate |
| InChIKey | YLWSGWORUDULID-BLFANLJRSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](O1)CO[C@@H](O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)