CAS 1316122-47-0 is the registry number for 3–(6–Chloropyridin–2–yl)–3–oxopropionitrile. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-(6-chloro-2-pyridinyl)-3-oxopropanenitrile (CAS 1316122-47-0) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 3-(6-chloro-2-pyridinyl)-3-oxopropanenitrile. InChIKey: YTZJJJDHWGOYFK-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-(6-chloro-2-pyridinyl)-3-oxopropanenitrile |
| InChIKey | YTZJJJDHWGOYFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C(=O)CC#N |
Computed by PubChem (NCBI)