CAS 131682-38-7 is the registry number for (R)-3-Acetoxy-2-phenylpropanoic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
(2R)-3-acetyloxy-2-phenylpropanoic acid (CAS 131682-38-7) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (2R)-3-acetyloxy-2-phenylpropanoic acid. InChIKey: OXGQBORIYFGJPM-JTQLQIEISA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2R)-3-acetyloxy-2-phenylpropanoic acid |
| InChIKey | OXGQBORIYFGJPM-JTQLQIEISA-N |
| SMILES | CC(=O)OC[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)