CAS 131682-41-2 is the registry number for Telbivudine Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 131682-41-2) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 1-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: IQFYYKKMVGJFEH-GJMOJQLCSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(2R,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-GJMOJQLCSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@H]([C@@H](O2)CO)O |
Computed by PubChem (NCBI)