Products 156968-81-9
CAS 156968-81-9 appears in our catalog under these names: Thymidine-1',2',3',4',5'-13C5, >95% (HPLC), Thymidine–13C5, Thymidine-13C5, 99.90%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 5 mg, 1 mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 156968-81-9) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 247.19 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: IQFYYKKMVGJFEH-DUGFCQTISA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 247.19 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-DUGFCQTISA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[13C@H]2[13CH2][13C@@H]([13C@H](O2)[13CH2]O)O |
Computed by PubChem (NCBI)