Products 13180-35-3
CAS 13180-35-3 is the registry number for 4-Oxo-2-phenyl-1,4-dihydroquinoline-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-oxo-2-phenyl-1H-quinoline-3-carboxylic acid (CAS 13180-35-3) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 4-oxo-2-phenyl-1H-quinoline-3-carboxylic acid. InChIKey: QGZKGXFOXVYJQE-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 4-oxo-2-phenyl-1H-quinoline-3-carboxylic acid |
| InChIKey | QGZKGXFOXVYJQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3N2)C(=O)O |
Computed by PubChem (NCBI)