CAS 13182-82-6 appears in our catalog under these names: Metronidazole Impurity 15, Metronidazole Acetate, >95% (HPLC), O-Acetylmetronidazole. Offered by: Hubei YoungXin, TRC, Mikromol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-methyl-5-nitroimidazol-1-yl)ethyl acetate (CAS 13182-82-6) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: 2-(2-methyl-5-nitroimidazol-1-yl)ethyl acetate. InChIKey: MQXDTGGRMOLAPU-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl acetate |
| InChIKey | MQXDTGGRMOLAPU-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)