CAS 1318777-54-6 appears in our catalog under these names: (R)-2-Acetamido-3-(benzylamino)-3-oxopropyl acetate, 98%, Lacosamide EP Impurity B (R-Isomer), Lacosamide EP Impurity B(R-Isomer), Lacosamide Impurity 2(Lacosamide EP Impurity B), O-Acetyl Lacosamide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl] acetate (CAS 1318777-54-6) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: [(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl] acetate. InChIKey: KQGUKRMTHAVMFN-CYBMUJFWSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | [(2R)-2-acetamido-3-(benzylamino)-3-oxopropyl] acetate |
| InChIKey | KQGUKRMTHAVMFN-CYBMUJFWSA-N |
| SMILES | CC(=O)N[C@H](COC(=O)C)C(=O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)