CAS 1320363-49-2 is the registry number for 3,3,4,4-Tetradeuterio-5-(3-(naphthalene-1-carbonyl)indol-1-yl)pentanoic acid. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg.
3,3,4,4-tetradeuterio-5-[3-(naphthalene-1-carbonyl)indol-1-yl]pentanoic acid (CAS 1320363-49-2) is a chemical compound with the molecular formula C24H21NO3 and a molecular weight of 375.5 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-5-[3-(naphthalene-1-carbonyl)indol-1-yl]pentanoic acid. InChIKey: BYIVGHIYNFQIJX-NZLXMSDQSA-N.
| Molecular formula | C24H21NO3 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-5-[3-(naphthalene-1-carbonyl)indol-1-yl]pentanoic acid |
| InChIKey | BYIVGHIYNFQIJX-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])CN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)