CAS 4181-21-9 appears in our catalog under these names: 1,1',1''-(Nitrilotris(benzene-4,1-diyl))triethanone 97%, 4,4′,4′′-Triacetyltriphenylamine, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[4-(4-acetyl-N-(4-acetylphenyl)anilino)phenyl]ethanone (CAS 4181-21-9) is a chemical compound with the molecular formula C24H21NO3 and a molecular weight of 371.4 g/mol. IUPAC name: 1-[4-(4-acetyl-N-(4-acetylphenyl)anilino)phenyl]ethanone. InChIKey: HMBWJXBLKJUNEP-UHFFFAOYSA-N.
| Molecular formula | C24H21NO3 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 1-[4-(4-acetyl-N-(4-acetylphenyl)anilino)phenyl]ethanone |
| InChIKey | HMBWJXBLKJUNEP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N(C2=CC=C(C=C2)C(=O)C)C3=CC=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)