Products 1951444-98-6

CAS 1951444-98-6 is the registry number for 2-Oxo-1-(triphenylmethyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-oxo-1-tritylpyrrolidine-3-carboxylic acid (CAS 1951444-98-6) is a chemical compound with the molecular formula C24H21NO3 and a molecular weight of 371.4 g/mol. IUPAC name: 2-oxo-1-tritylpyrrolidine-3-carboxylic acid. InChIKey: XCFPINPSWJALSP-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO3
Molecular weight371.4 g/mol
IUPAC name2-oxo-1-tritylpyrrolidine-3-carboxylic acid
InChIKeyXCFPINPSWJALSP-UHFFFAOYSA-N
SMILESC1CN(C(=O)C1C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)