CAS 1951444-98-6 is the registry number for 2-Oxo-1-(triphenylmethyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
2-oxo-1-tritylpyrrolidine-3-carboxylic acid (CAS 1951444-98-6) is a chemical compound with the molecular formula C24H21NO3 and a molecular weight of 371.4 g/mol. IUPAC name: 2-oxo-1-tritylpyrrolidine-3-carboxylic acid. InChIKey: XCFPINPSWJALSP-UHFFFAOYSA-N.
| Molecular formula | C24H21NO3 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 2-oxo-1-tritylpyrrolidine-3-carboxylic acid |
| InChIKey | XCFPINPSWJALSP-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)